C23H22N2O4 — CID 99818668
N'-[(1R)-1-(3-hydroxyphenyl)ethyl]-N-[4-(3-methylphenoxy)phenyl]oxamide (PubChem CID 99818668) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N'-[(1R)-1-(3-hydroxyphenyl)ethyl]-N-[4-(3-methylphenoxy)phenyl]oxamide.
| Compound Name | N'-[(1R)-1-(3-hydroxyphenyl)ethyl]-N-[4-(3-methylphenoxy)phenyl]oxamide |
|---|---|
| PubChem CID | 99818668 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N'-[(1R)-1-(3-hydroxyphenyl)ethyl]-N-[4-(3-methylphenoxy)phenyl]oxamide |
| SMILES | Cc1cccc(Oc2ccc(NC(=O)C(=O)N[C@H](C)c3cccc(O)c3)cc2)c1 |
| InChI | InChI=1S/C23H22N2O4/c1-15-5-3-8-21(13-15)29-20-11-9-18(10-12-20)25-23(28)22(27)24-16(2)17-6-4-7-19(26)14-17/h3-14,16,26H,1-2H3,(H,24,27)(H,25,28)/t16-/m1/s1 |
| InChIKey | WXLDAKHXIZPCLX-MRXNPFEDSA-N |
| XLogP | 4.31 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|