C10H15F3N4 — CID 167928995
1-[5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazol-3-yl]azepane (PubChem CID 167928995) has the molecular formula C10H15F3N4 and a molecular weight of 248.25 g/mol. Its IUPAC name is 1-[5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazol-3-yl]azepane.
| Compound Name | 1-[5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazol-3-yl]azepane |
|---|---|
| PubChem CID | 167928995 |
| Molecular Formula | C10H15F3N4 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-[5-(2,2,2-trifluoroethyl)-1H-1,2,4-triazol-3-yl]azepane |
| SMILES | FC(F)(F)Cc1nc(N2CCCCCC2)n[nH]1 |
| InChI | InChI=1S/C10H15F3N4/c11-10(12,13)7-8-14-9(16-15-8)17-5-3-1-2-4-6-17/h1-7H2,(H,14,15,16) |
| InChIKey | RVLYNKHARHKHDP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |