C9H15F2NO4 — CID 167936407
3-[(3,3-difluoro-4-hydroxybutyl)amino]-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 167936407) has the molecular formula C9H15F2NO4 and a molecular weight of 239.22 g/mol. Its IUPAC name is 3-[(3,3-difluoro-4-hydroxybutyl)amino]-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-[(3,3-difluoro-4-hydroxybutyl)amino]-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 167936407 |
| Molecular Formula | C9H15F2NO4 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 3-[(3,3-difluoro-4-hydroxybutyl)amino]-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)NCCC(F)(F)CO |
| InChI | InChI=1S/C9H15F2NO4/c1-8(2,7(15)16)6(14)12-4-3-9(10,11)5-13/h13H,3-5H2,1-2H3,(H,12,14)(H,15,16) |
| InChIKey | KCUCKOQFJKSPHX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|