C18H18ClN3O3S — CID 167937061
2-[4-(4-chloro-3-methylphenyl)sulfonylpiperazin-1-yl]-1,3-benzoxazole (PubChem CID 167937061) has the molecular formula C18H18ClN3O3S and a molecular weight of 391.88 g/mol. Its IUPAC name is 2-[4-(4-chloro-3-methylphenyl)sulfonylpiperazin-1-yl]-1,3-benzoxazole.
| Compound Name | 2-[4-(4-chloro-3-methylphenyl)sulfonylpiperazin-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 167937061 |
| Molecular Formula | C18H18ClN3O3S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-[4-(4-chloro-3-methylphenyl)sulfonylpiperazin-1-yl]-1,3-benzoxazole |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(c3nc4ccccc4o3)CC2)ccc1Cl |
| InChI | InChI=1S/C18H18ClN3O3S/c1-13-12-14(6-7-15(13)19)26(23,24)22-10-8-21(9-11-22)18-20-16-4-2-3-5-17(16)25-18/h2-7,12H,8-11H2,1H3 |
| InChIKey | UKFUOWGLKSNIPS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |