C18H19N3O3 — CID 167941860
N-methyl-N-(5-methyl-1,2-oxazol-3-yl)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 167941860) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-methyl-N-(5-methyl-1,2-oxazol-3-yl)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | N-methyl-N-(5-methyl-1,2-oxazol-3-yl)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 167941860 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-methyl-N-(5-methyl-1,2-oxazol-3-yl)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | C=CC(=O)N1CCCc2cc(C(=O)N(C)c3cc(C)on3)ccc21 |
| InChI | InChI=1S/C18H19N3O3/c1-4-17(22)21-9-5-6-13-11-14(7-8-15(13)21)18(23)20(3)16-10-12(2)24-19-16/h4,7-8,10-11H,1,5-6,9H2,2-3H3 |
| InChIKey | GYCBOACVVVEVOX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|