C24H23F3N2O2 — CID 166413362
N-(cyclopropylmethyl)-1-prop-2-enoyl-N-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 166413362) has the molecular formula C24H23F3N2O2 and a molecular weight of 428.45 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-prop-2-enoyl-N-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-1-prop-2-enoyl-N-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 166413362 |
| Molecular Formula | C24H23F3N2O2 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-(cyclopropylmethyl)-1-prop-2-enoyl-N-[3-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | C=CC(=O)N1CCCc2cc(C(=O)N(CC3CC3)c3cccc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C24H23F3N2O2/c1-2-22(30)28-12-4-5-17-13-18(10-11-21(17)28)23(31)29(15-16-8-9-16)20-7-3-6-19(14-20)24(25,26)27/h2-3,6-7,10-11,13-14,16H,1,4-5,8-9,12,15H2 |
| InChIKey | PAFLIOLWTJPCHW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|