C14H14N2O4 — CID 167942155
3-[(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)methyl]benzoic acid (PubChem CID 167942155) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 3-[(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)methyl]benzoic acid.
| Compound Name | 3-[(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 167942155 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-[(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2C(=O)CN(C3CC3)C2=O)c1 |
| InChI | InChI=1S/C14H14N2O4/c17-12-8-15(11-4-5-11)14(20)16(12)7-9-2-1-3-10(6-9)13(18)19/h1-3,6,11H,4-5,7-8H2,(H,18,19) |
| InChIKey | JAZRMDRLFNJJND-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|