C18H23N3O3 — CID 86883330
3-[(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)methyl]-N-(2-methylpropyl)benzamide (PubChem CID 86883330) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)methyl]-N-(2-methylpropyl)benzamide.
| Compound Name | 3-[(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)methyl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 86883330 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-[(3-cyclopropyl-2,5-dioxoimidazolidin-1-yl)methyl]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1cccc(CN2C(=O)CN(C3CC3)C2=O)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-12(2)9-19-17(23)14-5-3-4-13(8-14)10-21-16(22)11-20(18(21)24)15-6-7-15/h3-5,8,12,15H,6-7,9-11H2,1-2H3,(H,19,23) |
| InChIKey | URIAQMSZCDUUEE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|