C21H24KNO4 — CID 167942195
potassium (2S)-2-[(2-benzyl-4-phenylbutanoyl)amino]-4-hydroxybutanoate (PubChem CID 167942195) has the molecular formula C21H24KNO4 and a molecular weight of 393.52 g/mol. Its IUPAC name is potassium (2S)-2-[(2-benzyl-4-phenylbutanoyl)amino]-4-hydroxybutanoate.
| Compound Name | potassium (2S)-2-[(2-benzyl-4-phenylbutanoyl)amino]-4-hydroxybutanoate |
|---|---|
| PubChem CID | 167942195 |
| Molecular Formula | C21H24KNO4 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | potassium (2S)-2-[(2-benzyl-4-phenylbutanoyl)amino]-4-hydroxybutanoate |
| SMILES | O=C(N[C@@H](CCO)C(=O)[O-])C(CCc1ccccc1)Cc1ccccc1.[K+] |
| InChI | InChI=1S/C21H25NO4.K/c23-14-13-19(21(25)26)22-20(24)18(15-17-9-5-2-6-10-17)12-11-16-7-3-1-4-8-16;/h1-10,18-19,23H,11-15H2,(H,22,24)(H,25,26);/q;+1/p-1/t18?,19-;/m0./s1 |
| InChIKey | JTGUKKNRBXTQCD-DSJAQNLYSA-M |
| XLogP | -1.90 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |