C14H21N3O4S — CID 167943081
1-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-6-yl)-3-(3-propan-2-yloxypropyl)urea (PubChem CID 167943081) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-6-yl)-3-(3-propan-2-yloxypropyl)urea.
| Compound Name | 1-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-6-yl)-3-(3-propan-2-yloxypropyl)urea |
|---|---|
| PubChem CID | 167943081 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-6-yl)-3-(3-propan-2-yloxypropyl)urea |
| SMILES | CC(C)OCCCNC(=O)Nc1ccc2c(c1)S(=O)(=O)NC2 |
| InChI | InChI=1S/C14H21N3O4S/c1-10(2)21-7-3-6-15-14(18)17-12-5-4-11-9-16-22(19,20)13(11)8-12/h4-5,8,10,16H,3,6-7,9H2,1-2H3,(H2,15,17,18) |
| InChIKey | BKOQFUAWAPSVBP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|