C25H31N5O4S2 — CID 167953169
4-(2-benzylsulfanylethylamino)-2-methyl-3-nitro-N-[4-(pyridin-2-ylamino)butyl]benzenesulfonamide (PubChem CID 167953169) has the molecular formula C25H31N5O4S2 and a molecular weight of 529.69 g/mol. Its IUPAC name is 4-(2-benzylsulfanylethylamino)-2-methyl-3-nitro-N-[4-(pyridin-2-ylamino)butyl]benzenesulfonamide.
| Compound Name | 4-(2-benzylsulfanylethylamino)-2-methyl-3-nitro-N-[4-(pyridin-2-ylamino)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 167953169 |
| Molecular Formula | C25H31N5O4S2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 4-(2-benzylsulfanylethylamino)-2-methyl-3-nitro-N-[4-(pyridin-2-ylamino)butyl]benzenesulfonamide |
| SMILES | Cc1c(S(=O)(=O)NCCCCNc2ccccn2)ccc(NCCSCc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C25H31N5O4S2/c1-20-23(36(33,34)29-16-8-7-15-28-24-11-5-6-14-27-24)13-12-22(25(20)30(31)32)26-17-18-35-19-21-9-3-2-4-10-21/h2-6,9-14,26,29H,7-8,15-19H2,1H3,(H,27,28) |
| InChIKey | JXLKRXYESMPXMZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|