About 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide
4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide (PubChem CID 167957813) has the molecular formula C14H19N3O3
and a molecular weight of 277.32 g/mol. Its IUPAC name is 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide |
| PubChem CID | 167957813 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(N[C@@H]2C[C@@H](O)C23CCOCC3)ccn1 |
| InChI | InChI=1S/C14H19N3O3/c15-13(19)10-7-9(1-4-16-10)17-11-8-12(18)14(11)2-5-20-6-3-14/h1,4,7,11-12,18H,2-3,5-6,8H2,(H2,15,19)(H,16,17)/t11-,12-/m1/s1 |
| InChIKey | UUIDVXUOUZNFHS-VXGBXAGGSA-N |
| XLogP | 0.52 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide?
The IUPAC name of 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide (CID 167957813) is 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide.
What is the SMILES notation for 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide?
The canonical SMILES for 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide is NC(=O)c1cc(N[C@@H]2C[C@@H](O)C23CCOCC3)ccn1.
What is the InChIKey of 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide?
The InChIKey is UUIDVXUOUZNFHS-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H19N3O3/c15-13(19)10-7-9(1-4-16-10)17-11-8-12(18)14(11)2-5-20-6-3-14/h1,4,7,11-12,18H,2-3,5-6,8H2,(H2,15,19)(H,16,17)/t11-,12-/m1/s1.
What are the key properties of 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide?
4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide has a molecular weight of 277.32 g/mol, XLogP of 0.52, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]amino]pyridine-2-carboxamide is sourced from PubChem (CID 167957813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).