C24H16FN7O4 — CID 167960802
1-[4-[5-[1-(2-fluoro-4-nitrophenyl)pyrazol-3-yl]-1,2,4-oxadiazol-3-yl]phenyl]-3-phenylurea (PubChem CID 167960802) has the molecular formula C24H16FN7O4 and a molecular weight of 485.44 g/mol. Its IUPAC name is 1-[4-[5-[1-(2-fluoro-4-nitrophenyl)pyrazol-3-yl]-1,2,4-oxadiazol-3-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[5-[1-(2-fluoro-4-nitrophenyl)pyrazol-3-yl]-1,2,4-oxadiazol-3-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 167960802 |
| Molecular Formula | C24H16FN7O4 |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 1-[4-[5-[1-(2-fluoro-4-nitrophenyl)pyrazol-3-yl]-1,2,4-oxadiazol-3-yl]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(-c2noc(-c3ccn(-c4ccc([N+](=O)[O-])cc4F)n3)n2)cc1 |
| InChI | InChI=1S/C24H16FN7O4/c25-19-14-18(32(34)35)10-11-21(19)31-13-12-20(29-31)23-28-22(30-36-23)15-6-8-17(9-7-15)27-24(33)26-16-4-2-1-3-5-16/h1-14H,(H2,26,27,33) |
| InChIKey | JHAOKOIJYRRPDL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|