C15H24N4O2 — CID 167967745
2-[(Z)-[1-amino-2-(dimethylamino)ethylidene]amino]oxy-N-(2,5-dimethylphenyl)propanamide (PubChem CID 167967745) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[(Z)-[1-amino-2-(dimethylamino)ethylidene]amino]oxy-N-(2,5-dimethylphenyl)propanamide.
| Compound Name | 2-[(Z)-[1-amino-2-(dimethylamino)ethylidene]amino]oxy-N-(2,5-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 167967745 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-[(Z)-[1-amino-2-(dimethylamino)ethylidene]amino]oxy-N-(2,5-dimethylphenyl)propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(C)O/N=C(\N)CN(C)C)c1 |
| InChI | InChI=1S/C15H24N4O2/c1-10-6-7-11(2)13(8-10)17-15(20)12(3)21-18-14(16)9-19(4)5/h6-8,12H,9H2,1-5H3,(H2,16,18)(H,17,20) |
| InChIKey | AYYCTIAFIZVWDE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|