C18H19O5P — CID 167967871
2-[6-(3-dimethylphosphorylphenyl)-2,3-dihydro-1,4-benzodioxin-7-yl]acetic acid (PubChem CID 167967871) has the molecular formula C18H19O5P and a molecular weight of 346.32 g/mol. Its IUPAC name is 2-[6-(3-dimethylphosphorylphenyl)-2,3-dihydro-1,4-benzodioxin-7-yl]acetic acid.
| Compound Name | 2-[6-(3-dimethylphosphorylphenyl)-2,3-dihydro-1,4-benzodioxin-7-yl]acetic acid |
|---|---|
| PubChem CID | 167967871 |
| Molecular Formula | C18H19O5P |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[6-(3-dimethylphosphorylphenyl)-2,3-dihydro-1,4-benzodioxin-7-yl]acetic acid |
| SMILES | CP(C)(=O)c1cccc(-c2cc3c(cc2CC(=O)O)OCCO3)c1 |
| InChI | InChI=1S/C18H19O5P/c1-24(2,21)14-5-3-4-12(8-14)15-11-17-16(22-6-7-23-17)9-13(15)10-18(19)20/h3-5,8-9,11H,6-7,10H2,1-2H3,(H,19,20) |
| InChIKey | MKZIKZULVSARQX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|