C17H24ClNO4 — CID 167971957
2-chloro-N-(2-cyclopropyl-2-methoxyethyl)-N-[(3,5-dimethoxyphenyl)methyl]acetamide (PubChem CID 167971957) has the molecular formula C17H24ClNO4 and a molecular weight of 341.84 g/mol. Its IUPAC name is 2-chloro-N-(2-cyclopropyl-2-methoxyethyl)-N-[(3,5-dimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-chloro-N-(2-cyclopropyl-2-methoxyethyl)-N-[(3,5-dimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 167971957 |
| Molecular Formula | C17H24ClNO4 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-chloro-N-(2-cyclopropyl-2-methoxyethyl)-N-[(3,5-dimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(CN(CC(OC)C2CC2)C(=O)CCl)cc(OC)c1 |
| InChI | InChI=1S/C17H24ClNO4/c1-21-14-6-12(7-15(8-14)22-2)10-19(17(20)9-18)11-16(23-3)13-4-5-13/h6-8,13,16H,4-5,9-11H2,1-3H3 |
| InChIKey | ICHVMQSXWKTMRL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|