C18H13ClN2O4 — CID 167977825
N-(5-acetyl-2-hydroxyphenyl)-6-chloro-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 167977825) has the molecular formula C18H13ClN2O4 and a molecular weight of 356.77 g/mol. Its IUPAC name is N-(5-acetyl-2-hydroxyphenyl)-6-chloro-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-(5-acetyl-2-hydroxyphenyl)-6-chloro-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 167977825 |
| Molecular Formula | C18H13ClN2O4 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | N-(5-acetyl-2-hydroxyphenyl)-6-chloro-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CC(=O)c1ccc(O)c(NC(=O)c2cc(=O)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C18H13ClN2O4/c1-9(22)10-2-5-16(23)15(6-10)21-18(25)13-8-17(24)20-14-4-3-11(19)7-12(13)14/h2-8,23H,1H3,(H,20,24)(H,21,25) |
| InChIKey | VVYLRCXBWMVTHO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|