C15H23N7 — CID 167977988
4-(2-methylimidazol-1-yl)-N-(3-piperazin-1-ylpropyl)pyrimidin-2-amine (PubChem CID 167977988) has the molecular formula C15H23N7 and a molecular weight of 301.40 g/mol. Its IUPAC name is 4-(2-methylimidazol-1-yl)-N-(3-piperazin-1-ylpropyl)pyrimidin-2-amine.
| Compound Name | 4-(2-methylimidazol-1-yl)-N-(3-piperazin-1-ylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 167977988 |
| Molecular Formula | C15H23N7 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 4-(2-methylimidazol-1-yl)-N-(3-piperazin-1-ylpropyl)pyrimidin-2-amine |
| SMILES | Cc1nccn1-c1ccnc(NCCCN2CCNCC2)n1 |
| InChI | InChI=1S/C15H23N7/c1-13-17-8-12-22(13)14-3-5-19-15(20-14)18-4-2-9-21-10-6-16-7-11-21/h3,5,8,12,16H,2,4,6-7,9-11H2,1H3,(H,18,19,20) |
| InChIKey | DHHRMESWLQZOCK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|