C22H27N7 — CID 23535946
4-(2-anilinophenyl)-N-(3-piperazin-1-ylpropyl)-1,3,5-triazin-2-amine (PubChem CID 23535946) has the molecular formula C22H27N7 and a molecular weight of 389.51 g/mol. Its IUPAC name is 4-(2-anilinophenyl)-N-(3-piperazin-1-ylpropyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-anilinophenyl)-N-(3-piperazin-1-ylpropyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 23535946 |
| Molecular Formula | C22H27N7 |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 4-(2-anilinophenyl)-N-(3-piperazin-1-ylpropyl)-1,3,5-triazin-2-amine |
| SMILES | c1ccc(Nc2ccccc2-c2ncnc(NCCCN3CCNCC3)n2)cc1 |
| InChI | InChI=1S/C22H27N7/c1-2-7-18(8-3-1)27-20-10-5-4-9-19(20)21-25-17-26-22(28-21)24-11-6-14-29-15-12-23-13-16-29/h1-5,7-10,17,23,27H,6,11-16H2,(H,24,25,26,28) |
| InChIKey | XINDUCDPJFEOCG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|