C19H21ClN6O — CID 167978779
1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(2-pyrrolidin-2-ylpyrimidin-4-yl)urea (PubChem CID 167978779) has the molecular formula C19H21ClN6O and a molecular weight of 384.87 g/mol. Its IUPAC name is 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(2-pyrrolidin-2-ylpyrimidin-4-yl)urea.
| Compound Name | 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(2-pyrrolidin-2-ylpyrimidin-4-yl)urea |
|---|---|
| PubChem CID | 167978779 |
| Molecular Formula | C19H21ClN6O |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(2-pyrrolidin-2-ylpyrimidin-4-yl)urea |
| SMILES | O=C(NCCc1c[nH]c2ccc(Cl)cc12)Nc1ccnc(C2CCCN2)n1 |
| InChI | InChI=1S/C19H21ClN6O/c20-13-3-4-15-14(10-13)12(11-24-15)5-8-23-19(27)26-17-6-9-22-18(25-17)16-2-1-7-21-16/h3-4,6,9-11,16,21,24H,1-2,5,7-8H2,(H2,22,23,25,26,27) |
| InChIKey | CLBCTEYAUSESFV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |