C16H20ClN3OS — CID 119936135
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119936135) has the molecular formula C16H20ClN3OS and a molecular weight of 337.88 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119936135 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NCCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H20ClN3OS/c17-12-1-2-15-14(7-12)11(9-20-15)3-4-19-16(21)8-13-10-22-6-5-18-13/h1-2,7,9,13,18,20H,3-6,8,10H2,(H,19,21) |
| InChIKey | ZNUFHMFVFUNXCW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |