C17H24BNO5 — CID 167980474
[3-[1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl]oxy-2-formylphenyl]boronic acid (PubChem CID 167980474) has the molecular formula C17H24BNO5 and a molecular weight of 333.19 g/mol. Its IUPAC name is [3-[1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl]oxy-2-formylphenyl]boronic acid.
| Compound Name | [3-[1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl]oxy-2-formylphenyl]boronic acid |
|---|---|
| PubChem CID | 167980474 |
| Molecular Formula | C17H24BNO5 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | [3-[1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl]oxy-2-formylphenyl]boronic acid |
| SMILES | CC(Oc1cccc(B(O)O)c1C=O)C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C17H24BNO5/c1-12(17(21)19(2)13-7-4-3-5-8-13)24-16-10-6-9-15(18(22)23)14(16)11-20/h6,9-13,22-23H,3-5,7-8H2,1-2H3 |
| InChIKey | YOSUPXSYCKVHOB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|