C19H23BrFNO3 — CID 7650739
[(2R)-1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 7650739) has the molecular formula C19H23BrFNO3 and a molecular weight of 412.30 g/mol. Its IUPAC name is [(2R)-1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7650739 |
| Molecular Formula | C19H23BrFNO3 |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | [(2R)-1-[cyclohexyl(methyl)amino]-1-oxopropan-2-yl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1cc(Br)ccc1F)C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C19H23BrFNO3/c1-13(19(24)22(2)16-6-4-3-5-7-16)25-18(23)11-8-14-12-15(20)9-10-17(14)21/h8-13,16H,3-7H2,1-2H3/b11-8+/t13-/m1/s1 |
| InChIKey | FGALHLBJVJNISF-RUNBWSAHSA-N |
| XLogP | 4.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|