About [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate
[(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 9110557) has the molecular formula C15H14BrFO3
and a molecular weight of 341.18 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| PubChem CID | 9110557 |
| Molecular Formula | C15H14BrFO3 |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)O[C@H]1CCCCC1=O |
| InChI | InChI=1S/C15H14BrFO3/c16-11-6-7-12(17)10(9-11)5-8-15(19)20-14-4-2-1-3-13(14)18/h5-9,14H,1-4H2/b8-5+/t14-/m0/s1 |
| InChIKey | VXWJTEHHZALKRL-GPAKFWEMSA-N |
| XLogP | 3.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate?
The IUPAC name of [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (CID 9110557) is [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
What is the SMILES notation for [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate?
The canonical SMILES for [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate is O=C(/C=C/c1cc(Br)ccc1F)O[C@H]1CCCCC1=O.
What is the InChIKey of [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate?
The InChIKey is VXWJTEHHZALKRL-GPAKFWEMSA-N. The full InChI is InChI=1S/C15H14BrFO3/c16-11-6-7-12(17)10(9-11)5-8-15(19)20-14-4-2-1-3-13(14)18/h5-9,14H,1-4H2/b8-5+/t14-/m0/s1.
What are the key properties of [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate?
[(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate has a molecular weight of 341.18 g/mol, XLogP of 3.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2-oxocyclohexyl] (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate is sourced from PubChem (CID 9110557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).