C20H23NO3S2 — CID 167981142
1-(2,3-dihydroindol-1-yl)-3-[(4-ethylsulfonylphenyl)methylsulfanyl]propan-1-one (PubChem CID 167981142) has the molecular formula C20H23NO3S2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-3-[(4-ethylsulfonylphenyl)methylsulfanyl]propan-1-one.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-3-[(4-ethylsulfonylphenyl)methylsulfanyl]propan-1-one |
|---|---|
| PubChem CID | 167981142 |
| Molecular Formula | C20H23NO3S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-3-[(4-ethylsulfonylphenyl)methylsulfanyl]propan-1-one |
| SMILES | CCS(=O)(=O)c1ccc(CSCCC(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C20H23NO3S2/c1-2-26(23,24)18-9-7-16(8-10-18)15-25-14-12-20(22)21-13-11-17-5-3-4-6-19(17)21/h3-10H,2,11-15H2,1H3 |
| InChIKey | MXQVUVDEIWVJCW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|