C12H18ClN5O3 — CID 167992455
tert-butyl 3-[4-[(2-chloroacetyl)amino]triazol-2-yl]azetidine-1-carboxylate (PubChem CID 167992455) has the molecular formula C12H18ClN5O3 and a molecular weight of 315.76 g/mol. Its IUPAC name is tert-butyl 3-[4-[(2-chloroacetyl)amino]triazol-2-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[(2-chloroacetyl)amino]triazol-2-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 167992455 |
| Molecular Formula | C12H18ClN5O3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | tert-butyl 3-[4-[(2-chloroacetyl)amino]triazol-2-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(n2ncc(NC(=O)CCl)n2)C1 |
| InChI | InChI=1S/C12H18ClN5O3/c1-12(2,3)21-11(20)17-6-8(7-17)18-14-5-9(16-18)15-10(19)4-13/h5,8H,4,6-7H2,1-3H3,(H,15,16,19) |
| InChIKey | UFJPFFXLIKAOAO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|