C31H27Br2N3O6S — CID 167993565
N-(3,5-dibromophenyl)-4-methyl-N-[(1R)-3-[methyl-(4-methylphenyl)sulfonylamino]-1-(4-nitrophenyl)-3-oxopropyl]benzamide (PubChem CID 167993565) has the molecular formula C31H27Br2N3O6S and a molecular weight of 729.45 g/mol. Its IUPAC name is N-(3,5-dibromophenyl)-4-methyl-N-[(1R)-3-[methyl-(4-methylphenyl)sulfonylamino]-1-(4-nitrophenyl)-3-oxopropyl]benzamide.
| Compound Name | N-(3,5-dibromophenyl)-4-methyl-N-[(1R)-3-[methyl-(4-methylphenyl)sulfonylamino]-1-(4-nitrophenyl)-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 167993565 |
| Molecular Formula | C31H27Br2N3O6S |
| Molecular Weight | 729.45 g/mol |
| Exact Mass | 727.00 |
| IUPAC Name | N-(3,5-dibromophenyl)-4-methyl-N-[(1R)-3-[methyl-(4-methylphenyl)sulfonylamino]-1-(4-nitrophenyl)-3-oxopropyl]benzamide |
| SMILES | Cc1ccc(C(=O)N(c2cc(Br)cc(Br)c2)[C@H](CC(=O)N(C)S(=O)(=O)c2ccc(C)cc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C31H27Br2N3O6S/c1-20-4-8-23(9-5-20)31(38)35(27-17-24(32)16-25(33)18-27)29(22-10-12-26(13-11-22)36(39)40)19-30(37)34(3)43(41,42)28-14-6-21(2)7-15-28/h4-18,29H,19H2,1-3H3/t29-/m1/s1 |
| InChIKey | XQELKFHHWVTEGI-GDLZYMKVSA-N |
| XLogP | 7.36 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.45 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|