C31H26F3N3O6S — CID 167993597
N-[(1R)-3-[methyl-(4-methylphenyl)sulfonylamino]-1-(4-nitrophenyl)-3-oxopropyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 167993597) has the molecular formula C31H26F3N3O6S and a molecular weight of 625.63 g/mol. Its IUPAC name is N-[(1R)-3-[methyl-(4-methylphenyl)sulfonylamino]-1-(4-nitrophenyl)-3-oxopropyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[(1R)-3-[methyl-(4-methylphenyl)sulfonylamino]-1-(4-nitrophenyl)-3-oxopropyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 167993597 |
| Molecular Formula | C31H26F3N3O6S |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 625.15 |
| IUPAC Name | N-[(1R)-3-[methyl-(4-methylphenyl)sulfonylamino]-1-(4-nitrophenyl)-3-oxopropyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C(=O)C[C@H](c2ccc([N+](=O)[O-])cc2)N(C(=O)c2ccccc2)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C31H26F3N3O6S/c1-21-11-17-27(18-12-21)44(42,43)35(2)29(38)20-28(22-13-15-25(16-14-22)37(40)41)36(30(39)23-7-4-3-5-8-23)26-10-6-9-24(19-26)31(32,33)34/h3-19,28H,20H2,1-2H3/t28-/m1/s1 |
| InChIKey | OROVYCJEKSTUSB-MUUNZHRXSA-N |
| XLogP | 6.55 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|