C20H20FN5O3 — CID 167997453
2-(3,4-dioxo-8-phenyl-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl)-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 167997453) has the molecular formula C20H20FN5O3 and a molecular weight of 397.41 g/mol. Its IUPAC name is 2-(3,4-dioxo-8-phenyl-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl)-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(3,4-dioxo-8-phenyl-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl)-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 167997453 |
| Molecular Formula | C20H20FN5O3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-(3,4-dioxo-8-phenyl-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl)-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CN1NC2N(CCN2c2ccccc2)C(=O)C1=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FN5O3/c21-15-8-6-14(7-9-15)12-22-17(27)13-26-19(29)18(28)25-11-10-24(20(25)23-26)16-4-2-1-3-5-16/h1-9,20,23H,10-13H2,(H,22,27) |
| InChIKey | NROSFJVNZNDNOG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|