C13H19N6O2+ — CID 167998205
3,9-dimethyl-7-(2-methylpropyl)-4,5a-dihydro-1H-purino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 167998205) has the molecular formula C13H19N6O2+ and a molecular weight of 291.34 g/mol. Its IUPAC name is 3,9-dimethyl-7-(2-methylpropyl)-4,5a-dihydro-1H-purino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 3,9-dimethyl-7-(2-methylpropyl)-4,5a-dihydro-1H-purino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 167998205 |
| Molecular Formula | C13H19N6O2+ |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3,9-dimethyl-7-(2-methylpropyl)-4,5a-dihydro-1H-purino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CC1=NNC2=[N+](C1)C1C(=O)N(CC(C)C)C(=O)N(C)C1=N2 |
| InChI | InChI=1S/C13H18N6O2/c1-7(2)5-19-11(20)9-10(17(4)13(19)21)14-12-16-15-8(3)6-18(9)12/h7,9H,5-6H2,1-4H3/p+1 |
| InChIKey | ITHBNXHSUWJIFI-UHFFFAOYSA-O |
| XLogP | -0.34 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|