C12H17N6O2+ — CID 167999414
3,9-dimethyl-7-propyl-4,5a-dihydro-1H-purino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 167999414) has the molecular formula C12H17N6O2+ and a molecular weight of 277.31 g/mol. Its IUPAC name is 3,9-dimethyl-7-propyl-4,5a-dihydro-1H-purino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 3,9-dimethyl-7-propyl-4,5a-dihydro-1H-purino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 167999414 |
| Molecular Formula | C12H17N6O2+ |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 3,9-dimethyl-7-propyl-4,5a-dihydro-1H-purino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CCCN1C(=O)C2C(=NC3=[N+]2CC(C)=NN3)N(C)C1=O |
| InChI | InChI=1S/C12H16N6O2/c1-4-5-17-10(19)8-9(16(3)12(17)20)13-11-15-14-7(2)6-18(8)11/h8H,4-6H2,1-3H3/p+1 |
| InChIKey | BNXSALDYFLZVMD-UHFFFAOYSA-O |
| XLogP | -0.58 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|