C23H16N4O3 — CID 16815201
N-[2-(4-methylphenyl)imidazo[1,2-a]pyrimidin-3-yl]-2-oxochromene-3-carboxamide (PubChem CID 16815201) has the molecular formula C23H16N4O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is N-[2-(4-methylphenyl)imidazo[1,2-a]pyrimidin-3-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-(4-methylphenyl)imidazo[1,2-a]pyrimidin-3-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 16815201 |
| Molecular Formula | C23H16N4O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[2-(4-methylphenyl)imidazo[1,2-a]pyrimidin-3-yl]-2-oxochromene-3-carboxamide |
| SMILES | Cc1ccc(-c2nc3ncccn3c2NC(=O)c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C23H16N4O3/c1-14-7-9-15(10-8-14)19-20(27-12-4-11-24-23(27)25-19)26-21(28)17-13-16-5-2-3-6-18(16)30-22(17)29/h2-13H,1H3,(H,26,28) |
| InChIKey | DBDJNGFNJKKGPE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|