C25H25N3O3S4 — CID 16826134
N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 16826134) has the molecular formula C25H25N3O3S4 and a molecular weight of 543.76 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 16826134 |
| Molecular Formula | C25H25N3O3S4 |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1sc2c(c1-c1nc3ccccc3s1)CCCC2)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C25H25N3O3S4/c29-23(16-7-5-13-28(15-16)35(30,31)21-12-6-14-32-21)27-25-22(17-8-1-3-10-19(17)33-25)24-26-18-9-2-4-11-20(18)34-24/h2,4,6,9,11-12,14,16H,1,3,5,7-8,10,13,15H2,(H,27,29) |
| InChIKey | PTJZELSAMDQIKI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |