C20H23N5O4S3 — CID 41105725
(3S)-N'-[(2R)-2-(1,3-benzothiazol-2-ylamino)propanoyl]-1-thiophen-2-ylsulfonylpiperidine-3-carbohydrazide (PubChem CID 41105725) has the molecular formula C20H23N5O4S3 and a molecular weight of 493.64 g/mol. Its IUPAC name is (3S)-N'-[(2R)-2-(1,3-benzothiazol-2-ylamino)propanoyl]-1-thiophen-2-ylsulfonylpiperidine-3-carbohydrazide.
| Compound Name | (3S)-N'-[(2R)-2-(1,3-benzothiazol-2-ylamino)propanoyl]-1-thiophen-2-ylsulfonylpiperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 41105725 |
| Molecular Formula | C20H23N5O4S3 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | (3S)-N'-[(2R)-2-(1,3-benzothiazol-2-ylamino)propanoyl]-1-thiophen-2-ylsulfonylpiperidine-3-carbohydrazide |
| SMILES | C[C@@H](Nc1nc2ccccc2s1)C(=O)NNC(=O)[C@H]1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C20H23N5O4S3/c1-13(21-20-22-15-7-2-3-8-16(15)31-20)18(26)23-24-19(27)14-6-4-10-25(12-14)32(28,29)17-9-5-11-30-17/h2-3,5,7-9,11,13-14H,4,6,10,12H2,1H3,(H,21,22)(H,23,26)(H,24,27)/t13-,14+/m1/s1 |
| InChIKey | URIRGWZBELBBJK-KGLIPLIRSA-N |
| XLogP | 2.41 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|