C16H18ClN3O3S2 — CID 16826821
2-[1-(4-chlorophenyl)sulfonylpiperidin-2-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 16826821) has the molecular formula C16H18ClN3O3S2 and a molecular weight of 399.93 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonylpiperidin-2-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)sulfonylpiperidin-2-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 16826821 |
| Molecular Formula | C16H18ClN3O3S2 |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonylpiperidin-2-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CC1CCCCN1S(=O)(=O)c1ccc(Cl)cc1)Nc1nccs1 |
| InChI | InChI=1S/C16H18ClN3O3S2/c17-12-4-6-14(7-5-12)25(22,23)20-9-2-1-3-13(20)11-15(21)19-16-18-8-10-24-16/h4-8,10,13H,1-3,9,11H2,(H,18,19,21) |
| InChIKey | VSDUTPNJXJOMBB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |