C19H17N3O7S2 — CID 16829452
[6-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4-oxopyran-3-yl] 2,4-dimethoxybenzoate (PubChem CID 16829452) has the molecular formula C19H17N3O7S2 and a molecular weight of 463.49 g/mol. Its IUPAC name is [6-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4-oxopyran-3-yl] 2,4-dimethoxybenzoate.
| Compound Name | [6-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4-oxopyran-3-yl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 16829452 |
| Molecular Formula | C19H17N3O7S2 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | [6-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4-oxopyran-3-yl] 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2coc(CSc3nnc(NC(C)=O)s3)cc2=O)c(OC)c1 |
| InChI | InChI=1S/C19H17N3O7S2/c1-10(23)20-18-21-22-19(31-18)30-9-12-6-14(24)16(8-28-12)29-17(25)13-5-4-11(26-2)7-15(13)27-3/h4-8H,9H2,1-3H3,(H,20,21,23) |
| InChIKey | SXURCPRKKNFXNS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|