C14H14ClN3O5S2 — CID 7543155
[6-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4-oxopyran-3-yl] 4-chlorobutanoate (PubChem CID 7543155) has the molecular formula C14H14ClN3O5S2 and a molecular weight of 403.87 g/mol. Its IUPAC name is [6-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4-oxopyran-3-yl] 4-chlorobutanoate.
| Compound Name | [6-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4-oxopyran-3-yl] 4-chlorobutanoate |
|---|---|
| PubChem CID | 7543155 |
| Molecular Formula | C14H14ClN3O5S2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | [6-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4-oxopyran-3-yl] 4-chlorobutanoate |
| SMILES | CC(=O)Nc1nnc(SCc2cc(=O)c(OC(=O)CCCCl)co2)s1 |
| InChI | InChI=1S/C14H14ClN3O5S2/c1-8(19)16-13-17-18-14(25-13)24-7-9-5-10(20)11(6-22-9)23-12(21)3-2-4-15/h5-6H,2-4,7H2,1H3,(H,16,17,19) |
| InChIKey | AKAKURZQYSUWTM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|