C16H19N3O5S2 — CID 7543138
[6-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4-oxopyran-3-yl] 2-ethylbutanoate (PubChem CID 7543138) has the molecular formula C16H19N3O5S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is [6-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4-oxopyran-3-yl] 2-ethylbutanoate.
| Compound Name | [6-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4-oxopyran-3-yl] 2-ethylbutanoate |
|---|---|
| PubChem CID | 7543138 |
| Molecular Formula | C16H19N3O5S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [6-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-4-oxopyran-3-yl] 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)Oc1coc(CSc2nnc(NC(C)=O)s2)cc1=O |
| InChI | InChI=1S/C16H19N3O5S2/c1-4-10(5-2)14(22)24-13-7-23-11(6-12(13)21)8-25-16-19-18-15(26-16)17-9(3)20/h6-7,10H,4-5,8H2,1-3H3,(H,17,18,20) |
| InChIKey | CGJSTFONEFWEPP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|