C17H19N3O5S2 — CID 7543182
[4-oxo-6-[[5-(propanoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]pyran-3-yl] cyclopentanecarboxylate (PubChem CID 7543182) has the molecular formula C17H19N3O5S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is [4-oxo-6-[[5-(propanoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]pyran-3-yl] cyclopentanecarboxylate.
| Compound Name | [4-oxo-6-[[5-(propanoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]pyran-3-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 7543182 |
| Molecular Formula | C17H19N3O5S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | [4-oxo-6-[[5-(propanoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]pyran-3-yl] cyclopentanecarboxylate |
| SMILES | CCC(=O)Nc1nnc(SCc2cc(=O)c(OC(=O)C3CCCC3)co2)s1 |
| InChI | InChI=1S/C17H19N3O5S2/c1-2-14(22)18-16-19-20-17(27-16)26-9-11-7-12(21)13(8-24-11)25-15(23)10-5-3-4-6-10/h7-8,10H,2-6,9H2,1H3,(H,18,19,22) |
| InChIKey | ZOIHYNJWLUXONU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|