C23H22ClN3O5S2 — CID 18572934
[4-oxo-6-[[5-(propanoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]pyran-3-yl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate (PubChem CID 18572934) has the molecular formula C23H22ClN3O5S2 and a molecular weight of 520.03 g/mol. Its IUPAC name is [4-oxo-6-[[5-(propanoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]pyran-3-yl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [4-oxo-6-[[5-(propanoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]pyran-3-yl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 18572934 |
| Molecular Formula | C23H22ClN3O5S2 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | [4-oxo-6-[[5-(propanoylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]pyran-3-yl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate |
| SMILES | CCC(=O)Nc1nnc(SCc2cc(=O)c(OC(=O)C3(c4ccc(Cl)cc4)CCCC3)co2)s1 |
| InChI | InChI=1S/C23H22ClN3O5S2/c1-2-19(29)25-21-26-27-22(34-21)33-13-16-11-17(28)18(12-31-16)32-20(30)23(9-3-4-10-23)14-5-7-15(24)8-6-14/h5-8,11-12H,2-4,9-10,13H2,1H3,(H,25,26,29) |
| InChIKey | POQYWWXHNHYZPA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|