C20H16N4O7S2 — CID 18572969
[6-[[5-(cyclopropanecarbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-4-oxopyran-3-yl] 4-methyl-3-nitrobenzoate (PubChem CID 18572969) has the molecular formula C20H16N4O7S2 and a molecular weight of 488.50 g/mol. Its IUPAC name is [6-[[5-(cyclopropanecarbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-4-oxopyran-3-yl] 4-methyl-3-nitrobenzoate.
| Compound Name | [6-[[5-(cyclopropanecarbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-4-oxopyran-3-yl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 18572969 |
| Molecular Formula | C20H16N4O7S2 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | [6-[[5-(cyclopropanecarbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-4-oxopyran-3-yl] 4-methyl-3-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)Oc2coc(CSc3nnc(NC(=O)C4CC4)s3)cc2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16N4O7S2/c1-10-2-3-12(6-14(10)24(28)29)18(27)31-16-8-30-13(7-15(16)25)9-32-20-23-22-19(33-20)21-17(26)11-4-5-11/h2-3,6-8,11H,4-5,9H2,1H3,(H,21,22,26) |
| InChIKey | PFIUBWRKHZLHRD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|