C25H19N3O5S2 — CID 18572977
[6-[[5-(cyclopropanecarbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-4-oxopyran-3-yl] 4-phenylbenzoate (PubChem CID 18572977) has the molecular formula C25H19N3O5S2 and a molecular weight of 505.58 g/mol. Its IUPAC name is [6-[[5-(cyclopropanecarbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-4-oxopyran-3-yl] 4-phenylbenzoate.
| Compound Name | [6-[[5-(cyclopropanecarbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-4-oxopyran-3-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 18572977 |
| Molecular Formula | C25H19N3O5S2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | [6-[[5-(cyclopropanecarbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-4-oxopyran-3-yl] 4-phenylbenzoate |
| SMILES | O=C(Oc1coc(CSc2nnc(NC(=O)C3CC3)s2)cc1=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H19N3O5S2/c29-20-12-19(14-34-25-28-27-24(35-25)26-22(30)17-8-9-17)32-13-21(20)33-23(31)18-10-6-16(7-11-18)15-4-2-1-3-5-15/h1-7,10-13,17H,8-9,14H2,(H,26,27,30) |
| InChIKey | QNVFUALBEWZRMV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|