C21H12F3N3O5S3 — CID 18573093
[4-oxo-6-[[5-(thiophene-2-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]pyran-3-yl] 3-(trifluoromethyl)benzoate (PubChem CID 18573093) has the molecular formula C21H12F3N3O5S3 and a molecular weight of 539.54 g/mol. Its IUPAC name is [4-oxo-6-[[5-(thiophene-2-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]pyran-3-yl] 3-(trifluoromethyl)benzoate.
| Compound Name | [4-oxo-6-[[5-(thiophene-2-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]pyran-3-yl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 18573093 |
| Molecular Formula | C21H12F3N3O5S3 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 538.99 |
| IUPAC Name | [4-oxo-6-[[5-(thiophene-2-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]pyran-3-yl] 3-(trifluoromethyl)benzoate |
| SMILES | O=C(Oc1coc(CSc2nnc(NC(=O)c3cccs3)s2)cc1=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H12F3N3O5S3/c22-21(23,24)12-4-1-3-11(7-12)18(30)32-15-9-31-13(8-14(15)28)10-34-20-27-26-19(35-20)25-17(29)16-5-2-6-33-16/h1-9H,10H2,(H,25,26,29) |
| InChIKey | NBJQQSFKPFZWMP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|