About methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide
methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide (PubChem CID 16833492) has the molecular formula C17H17BrN2O2
and a molecular weight of 361.24 g/mol. Its IUPAC name is methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide.
Molecular Properties
| Compound Name | methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide |
| PubChem CID | 16833492 |
| Molecular Formula | C17H17BrN2O2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide |
| SMILES | Br.COC(=O)c1ccc(N2Cc3ccccc3C=C2N)cc1 |
| InChI | InChI=1S/C17H16N2O2.BrH/c1-21-17(20)12-6-8-15(9-7-12)19-11-14-5-3-2-4-13(14)10-16(19)18;/h2-10H,11,18H2,1H3;1H |
| InChIKey | VWLKZOSVWRUNQM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide?
The IUPAC name of methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide (CID 16833492) is methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide.
What is the SMILES notation for methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide?
The canonical SMILES for methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide is Br.COC(=O)c1ccc(N2Cc3ccccc3C=C2N)cc1.
What is the InChIKey of methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide?
The InChIKey is VWLKZOSVWRUNQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2.BrH/c1-21-17(20)12-6-8-15(9-7-12)19-11-14-5-3-2-4-13(14)10-16(19)18;/h2-10H,11,18H2,1H3;1H.
What are the key properties of methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide?
methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide has a molecular weight of 361.24 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-amino-1H-isoquinolin-2-yl)benzoate;hydrobromide is sourced from PubChem (CID 16833492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).