C15H15NO2 — CID 168501746
1-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-ethynylpyrrolidin-2-one (PubChem CID 168501746) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168501746 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(Cc2ccc3c(c2)CCO3)C1 |
| InChI | InChI=1S/C15H15NO2/c1-2-11-8-15(17)16(9-11)10-12-3-4-14-13(7-12)5-6-18-14/h1,3-4,7,11H,5-6,8-10H2 |
| InChIKey | BTTKSGASTLXNMV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|