C9H8BrN3O2 — CID 168505881
5-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazole-4-carbonitrile (PubChem CID 168505881) has the molecular formula C9H8BrN3O2 and a molecular weight of 270.09 g/mol. Its IUPAC name is 5-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazole-4-carbonitrile.
| Compound Name | 5-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 168505881 |
| Molecular Formula | C9H8BrN3O2 |
| Molecular Weight | 270.09 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | 5-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazole-4-carbonitrile |
| SMILES | N#Cc1cnoc1N1CC(CBr)CC1=O |
| InChI | InChI=1S/C9H8BrN3O2/c10-2-6-1-8(14)13(5-6)9-7(3-11)4-12-15-9/h4,6H,1-2,5H2 |
| InChIKey | VAEPIPJKSBSNEW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.09 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|