C15H9FN2O3 — CID 168517087
3-(1,3-dioxoisoindol-2-yl)-5-fluorobenzamide (PubChem CID 168517087) has the molecular formula C15H9FN2O3 and a molecular weight of 284.25 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-5-fluorobenzamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 168517087 |
| Molecular Formula | C15H9FN2O3 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-5-fluorobenzamide |
| SMILES | NC(=O)c1cc(F)cc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C15H9FN2O3/c16-9-5-8(13(17)19)6-10(7-9)18-14(20)11-3-1-2-4-12(11)15(18)21/h1-7H,(H2,17,19) |
| InChIKey | ZZKQZUBMEUEJQV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|