C17H11I2NO4 — CID 168517610
ethyl 4-(1,3-dioxoisoindol-2-yl)-3,5-diiodobenzoate (PubChem CID 168517610) has the molecular formula C17H11I2NO4 and a molecular weight of 547.09 g/mol. Its IUPAC name is ethyl 4-(1,3-dioxoisoindol-2-yl)-3,5-diiodobenzoate.
| Compound Name | ethyl 4-(1,3-dioxoisoindol-2-yl)-3,5-diiodobenzoate |
|---|---|
| PubChem CID | 168517610 |
| Molecular Formula | C17H11I2NO4 |
| Molecular Weight | 547.09 g/mol |
| Exact Mass | 546.88 |
| IUPAC Name | ethyl 4-(1,3-dioxoisoindol-2-yl)-3,5-diiodobenzoate |
| SMILES | CCOC(=O)c1cc(I)c(N2C(=O)c3ccccc3C2=O)c(I)c1 |
| InChI | InChI=1S/C17H11I2NO4/c1-2-24-17(23)9-7-12(18)14(13(19)8-9)20-15(21)10-5-3-4-6-11(10)16(20)22/h3-8H,2H2,1H3 |
| InChIKey | MTHUFLDLRSBKLB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.09 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|