C11H8ClN3OS — CID 168522201
N-(7-chloro-2-methyl-1,3-benzothiazol-6-yl)-2-cyanoacetamide (PubChem CID 168522201) has the molecular formula C11H8ClN3OS and a molecular weight of 265.73 g/mol. Its IUPAC name is N-(7-chloro-2-methyl-1,3-benzothiazol-6-yl)-2-cyanoacetamide.
| Compound Name | N-(7-chloro-2-methyl-1,3-benzothiazol-6-yl)-2-cyanoacetamide |
|---|---|
| PubChem CID | 168522201 |
| Molecular Formula | C11H8ClN3OS |
| Molecular Weight | 265.73 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | N-(7-chloro-2-methyl-1,3-benzothiazol-6-yl)-2-cyanoacetamide |
| SMILES | Cc1nc2ccc(NC(=O)CC#N)c(Cl)c2s1 |
| InChI | InChI=1S/C11H8ClN3OS/c1-6-14-8-3-2-7(10(12)11(8)17-6)15-9(16)4-5-13/h2-3H,4H2,1H3,(H,15,16) |
| InChIKey | IUDHKBNEIAEYGW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.73 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |