C14H15Cl2NO — CID 168525372
4,5-dichloro-2-(furan-2-yl)-N-(2-methylpropyl)aniline (PubChem CID 168525372) has the molecular formula C14H15Cl2NO and a molecular weight of 284.19 g/mol. Its IUPAC name is 4,5-dichloro-2-(furan-2-yl)-N-(2-methylpropyl)aniline.
| Compound Name | 4,5-dichloro-2-(furan-2-yl)-N-(2-methylpropyl)aniline |
|---|---|
| PubChem CID | 168525372 |
| Molecular Formula | C14H15Cl2NO |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4,5-dichloro-2-(furan-2-yl)-N-(2-methylpropyl)aniline |
| SMILES | CC(C)CNc1cc(Cl)c(Cl)cc1-c1ccco1 |
| InChI | InChI=1S/C14H15Cl2NO/c1-9(2)8-17-13-7-12(16)11(15)6-10(13)14-4-3-5-18-14/h3-7,9,17H,8H2,1-2H3 |
| InChIKey | KUUMXUBUVAQNDB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |